C9H11BO3 — CID 125426923
(3R)-1-hydroxy-6-methoxy-3-methyl-3H-2,1-benzoxaborole (PubChem CID 125426923) has the molecular formula C9H11BO3 and a molecular weight of 178.00 g/mol. Its IUPAC name is (3R)-1-hydroxy-6-methoxy-3-methyl-3H-2,1-benzoxaborole.
| Compound Name | (3R)-1-hydroxy-6-methoxy-3-methyl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 125426923 |
| Molecular Formula | C9H11BO3 |
| Molecular Weight | 178.00 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (3R)-1-hydroxy-6-methoxy-3-methyl-3H-2,1-benzoxaborole |
| SMILES | COc1ccc2c(c1)B(O)O[C@@H]2C |
| InChI | InChI=1S/C9H11BO3/c1-6-8-4-3-7(12-2)5-9(8)10(11)13-6/h3-6,11H,1-2H3/t6-/m1/s1 |
| InChIKey | PCGVKBCZKISFBL-ZCFIWIBFSA-N |
| XLogP | 0.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.00 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|