C10H14BNO2 — CID 139692111
6-methoxy-2,4-dimethyl-3,4-dihydro-1,3,2-benzoxazaborinine (PubChem CID 139692111) has the molecular formula C10H14BNO2 and a molecular weight of 191.04 g/mol. Its IUPAC name is 6-methoxy-2,4-dimethyl-3,4-dihydro-1,3,2-benzoxazaborinine.
| Compound Name | 6-methoxy-2,4-dimethyl-3,4-dihydro-1,3,2-benzoxazaborinine |
|---|---|
| PubChem CID | 139692111 |
| Molecular Formula | C10H14BNO2 |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 6-methoxy-2,4-dimethyl-3,4-dihydro-1,3,2-benzoxazaborinine |
| SMILES | COc1ccc2c(c1)C(C)NB(C)O2 |
| InChI | InChI=1S/C10H14BNO2/c1-7-9-6-8(13-3)4-5-10(9)14-11(2)12-7/h4-7,12H,1-3H3 |
| InChIKey | NJWYJXBTTAYHEB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|