C10H12O2 — CID 102492939
5-methoxy-3-methyl-2,3-dihydro-1-benzofuran (PubChem CID 102492939) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 5-methoxy-3-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-methoxy-3-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 102492939 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 5-methoxy-3-methyl-2,3-dihydro-1-benzofuran |
| SMILES | COc1ccc2c(c1)C(C)CO2 |
| InChI | InChI=1S/C10H12O2/c1-7-6-12-10-4-3-8(11-2)5-9(7)10/h3-5,7H,6H2,1-2H3 |
| InChIKey | JGGCGHQLNDSPDT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |