C10H10F2O2 — CID 125488470
(3R)-3-(difluoromethyl)-5-methoxy-2,3-dihydro-1-benzofuran (PubChem CID 125488470) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is (3R)-3-(difluoromethyl)-5-methoxy-2,3-dihydro-1-benzofuran.
| Compound Name | (3R)-3-(difluoromethyl)-5-methoxy-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 125488470 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (3R)-3-(difluoromethyl)-5-methoxy-2,3-dihydro-1-benzofuran |
| SMILES | COc1ccc2c(c1)[C@@H](C(F)F)CO2 |
| InChI | InChI=1S/C10H10F2O2/c1-13-6-2-3-9-7(4-6)8(5-14-9)10(11)12/h2-4,8,10H,5H2,1H3/t8-/m0/s1 |
| InChIKey | LVRBHTMNFYNWNB-QMMMGPOBSA-N |
| XLogP | 2.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |