C11H15NO3 — CID 81482055
N,5-dimethoxy-2-methyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 81482055) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is N,5-dimethoxy-2-methyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | N,5-dimethoxy-2-methyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 81482055 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N,5-dimethoxy-2-methyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CONC1c2cc(OC)ccc2OC1C |
| InChI | InChI=1S/C11H15NO3/c1-7-11(12-14-3)9-6-8(13-2)4-5-10(9)15-7/h4-7,11-12H,1-3H3 |
| InChIKey | FUUCJHVPSHQRQI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|