C12H17NO3 — CID 81482112
2-ethyl-N,6-dimethoxy-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 81482112) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-ethyl-N,6-dimethoxy-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 2-ethyl-N,6-dimethoxy-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 81482112 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-ethyl-N,6-dimethoxy-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCC1Oc2cc(OC)ccc2C1NOC |
| InChI | InChI=1S/C12H17NO3/c1-4-10-12(13-15-3)9-6-5-8(14-2)7-11(9)16-10/h5-7,10,12-13H,4H2,1-3H3 |
| InChIKey | WYMHBZCHHIAXSX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|