C12H17NO2 — CID 81482053
2-ethyl-N-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 81482053) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-ethyl-N-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 2-ethyl-N-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 81482053 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-ethyl-N-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCC1Oc2ccc(C)cc2C1NOC |
| InChI | InChI=1S/C12H17NO2/c1-4-10-12(13-14-3)9-7-8(2)5-6-11(9)15-10/h5-7,10,12-13H,4H2,1-3H3 |
| InChIKey | BBDOQRNMFJFQAK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|