C12H16O2 — CID 166439561
(1R)-5-methoxy-1,3,3-trimethyl-1H-2-benzofuran (PubChem CID 166439561) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R)-5-methoxy-1,3,3-trimethyl-1H-2-benzofuran.
| Compound Name | (1R)-5-methoxy-1,3,3-trimethyl-1H-2-benzofuran |
|---|---|
| PubChem CID | 166439561 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1R)-5-methoxy-1,3,3-trimethyl-1H-2-benzofuran |
| SMILES | COc1ccc2c(c1)C(C)(C)O[C@@H]2C |
| InChI | InChI=1S/C12H16O2/c1-8-10-6-5-9(13-4)7-11(10)12(2,3)14-8/h5-8H,1-4H3/t8-/m1/s1 |
| InChIKey | OPPYKGCZSAVYRY-MRVPVSSYSA-N |
| XLogP | 3.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |