C12H16NO+ — CID 68591089
5-methoxy-1,3,3-trimethylindol-1-ium (PubChem CID 68591089) has the molecular formula C12H16NO+ and a molecular weight of 190.27 g/mol. Its IUPAC name is 5-methoxy-1,3,3-trimethylindol-1-ium.
| Compound Name | 5-methoxy-1,3,3-trimethylindol-1-ium |
|---|---|
| PubChem CID | 68591089 |
| Molecular Formula | C12H16NO+ |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 5-methoxy-1,3,3-trimethylindol-1-ium |
| SMILES | COc1ccc2c(c1)C(C)(C)C=[N+]2C |
| InChI | InChI=1S/C12H16NO/c1-12(2)8-13(3)11-6-5-9(14-4)7-10(11)12/h5-8H,1-4H3/q+1 |
| InChIKey | OGYFIHPGOLVCJN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|