About 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride
5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride (PubChem CID 69114880) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride.
Molecular Properties
| Compound Name | 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride |
| PubChem CID | 69114880 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride |
| SMILES | COc1ccc2c(c1)C(C)(C)C(C)=[N+]2C.[Cl-] |
| InChI | InChI=1S/C13H18NO.ClH/c1-9-13(2,3)11-8-10(15-5)6-7-12(11)14(9)4;/h6-8H,1-5H3;1H/q+1;/p-1 |
| InChIKey | RTEXTLDENUBCSO-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride?
The IUPAC name of 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride (CID 69114880) is 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride.
What is the SMILES notation for 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride?
The canonical SMILES for 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride is COc1ccc2c(c1)C(C)(C)C(C)=[N+]2C.[Cl-].
What is the InChIKey of 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride?
The InChIKey is RTEXTLDENUBCSO-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H18NO.ClH/c1-9-13(2,3)11-8-10(15-5)6-7-12(11)14(9)4;/h6-8H,1-5H3;1H/q+1;/p-1.
What are the key properties of 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride?
5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride has a molecular weight of 239.75 g/mol, XLogP of -0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,2,3,3-tetramethylindol-1-ium chloride is sourced from PubChem (CID 69114880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).