C13H17N2O3+ — CID 22600713
5-methoxy-1,2,3,3-tetramethyl-6-nitroindol-1-ium (PubChem CID 22600713) has the molecular formula C13H17N2O3+ and a molecular weight of 249.29 g/mol. Its IUPAC name is 5-methoxy-1,2,3,3-tetramethyl-6-nitroindol-1-ium.
| Compound Name | 5-methoxy-1,2,3,3-tetramethyl-6-nitroindol-1-ium |
|---|---|
| PubChem CID | 22600713 |
| Molecular Formula | C13H17N2O3+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 5-methoxy-1,2,3,3-tetramethyl-6-nitroindol-1-ium |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])[N+](C)=C(C)C2(C)C |
| InChI | InChI=1S/C13H17N2O3/c1-8-13(2,3)9-6-12(18-5)11(15(16)17)7-10(9)14(8)4/h6-7H,1-5H3/q+1 |
| InChIKey | NPWLZUUHCCVLQS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|