C16H23NO2 — CID 22806491
(4aR,10bS)-9-methoxy-2,6,6-trimethyl-3,4,4a,10b-tetrahydro-1H-isochromeno[4,3-c]pyridine (PubChem CID 22806491) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (4aR,10bS)-9-methoxy-2,6,6-trimethyl-3,4,4a,10b-tetrahydro-1H-isochromeno[4,3-c]pyridine.
| Compound Name | (4aR,10bS)-9-methoxy-2,6,6-trimethyl-3,4,4a,10b-tetrahydro-1H-isochromeno[4,3-c]pyridine |
|---|---|
| PubChem CID | 22806491 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4aR,10bS)-9-methoxy-2,6,6-trimethyl-3,4,4a,10b-tetrahydro-1H-isochromeno[4,3-c]pyridine |
| SMILES | COc1ccc2c(c1)[C@H]1CN(C)CC[C@H]1OC2(C)C |
| InChI | InChI=1S/C16H23NO2/c1-16(2)14-6-5-11(18-4)9-12(14)13-10-17(3)8-7-15(13)19-16/h5-6,9,13,15H,7-8,10H2,1-4H3/t13-,15-/m1/s1 |
| InChIKey | LKEFXJOMQHNOTO-UKRRQHHQSA-N |
| XLogP | 2.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |