C11H13BO5 — CID 124636435
methyl 3-[(3S)-1,6-dihydroxy-3H-2,1-benzoxaborol-3-yl]propanoate (PubChem CID 124636435) has the molecular formula C11H13BO5 and a molecular weight of 236.03 g/mol. Its IUPAC name is methyl 3-[(3S)-1,6-dihydroxy-3H-2,1-benzoxaborol-3-yl]propanoate.
| Compound Name | methyl 3-[(3S)-1,6-dihydroxy-3H-2,1-benzoxaborol-3-yl]propanoate |
|---|---|
| PubChem CID | 124636435 |
| Molecular Formula | C11H13BO5 |
| Molecular Weight | 236.03 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | methyl 3-[(3S)-1,6-dihydroxy-3H-2,1-benzoxaborol-3-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1OB(O)c2cc(O)ccc21 |
| InChI | InChI=1S/C11H13BO5/c1-16-11(14)5-4-10-8-3-2-7(13)6-9(8)12(15)17-10/h2-3,6,10,13,15H,4-5H2,1H3/t10-/m0/s1 |
| InChIKey | XURCIHQUTJPECV-JTQLQIEISA-N |
| XLogP | 0.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.03 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|