2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid

C11H12O3S — CID 83911058

IUPAC2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid
SMILESCOc1ccc2c(c1)C(CC(=O)O)CS2
InChIInChI=1S/C11H12O3S/c1-14-8-2-3-10-9(5-8)7(6-15-10)4-11(12)13/h2-3,5,7H,4,6H2,1H3,(H,12,13)
InChIKeyZHVKLFVAVYKPCR-UHFFFAOYSA-N
MW224.28 g/mol
LogP2.36
Rot. Bonds3

About 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid

2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid (PubChem CID 83911058) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid.

Molecular Properties

Compound Name2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid
PubChem CID83911058
Molecular FormulaC11H12O3S
Molecular Weight224.28 g/mol
Exact Mass224.05
IUPAC Name2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid
SMILESCOc1ccc2c(c1)C(CC(=O)O)CS2
InChIInChI=1S/C11H12O3S/c1-14-8-2-3-10-9(5-8)7(6-15-10)4-11(12)13/h2-3,5,7H,4,6H2,1H3,(H,12,13)
InChIKeyZHVKLFVAVYKPCR-UHFFFAOYSA-N
XLogP2.36
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.28
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid?
The IUPAC name of 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid (CID 83911058) is 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid.
What is the SMILES notation for 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid?
The canonical SMILES for 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid is COc1ccc2c(c1)C(CC(=O)O)CS2.
What is the InChIKey of 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid?
The InChIKey is ZHVKLFVAVYKPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3S/c1-14-8-2-3-10-9(5-8)7(6-15-10)4-11(12)13/h2-3,5,7H,4,6H2,1H3,(H,12,13).
What are the key properties of 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid?
2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid has a molecular weight of 224.28 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid is sourced from PubChem (CID 83911058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).