C12H14ClNO3S — CID 10637051
2-chloro-N-[(3R,4S)-4-hydroxy-6-methoxy-3,4-dihydro-2H-thiochromen-3-yl]acetamide (PubChem CID 10637051) has the molecular formula C12H14ClNO3S and a molecular weight of 287.77 g/mol. Its IUPAC name is 2-chloro-N-[(3R,4S)-4-hydroxy-6-methoxy-3,4-dihydro-2H-thiochromen-3-yl]acetamide.
| Compound Name | 2-chloro-N-[(3R,4S)-4-hydroxy-6-methoxy-3,4-dihydro-2H-thiochromen-3-yl]acetamide |
|---|---|
| PubChem CID | 10637051 |
| Molecular Formula | C12H14ClNO3S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-chloro-N-[(3R,4S)-4-hydroxy-6-methoxy-3,4-dihydro-2H-thiochromen-3-yl]acetamide |
| SMILES | COc1ccc2c(c1)[C@H](O)[C@@H](NC(=O)CCl)CS2 |
| InChI | InChI=1S/C12H14ClNO3S/c1-17-7-2-3-10-8(4-7)12(16)9(6-18-10)14-11(15)5-13/h2-4,9,12,16H,5-6H2,1H3,(H,14,15)/t9-,12-/m0/s1 |
| InChIKey | SXGFQVRNMOSEGC-CABZTGNLSA-N |
| XLogP | 1.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|