2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid

C11H13NO3S — CID 84629451

IUPAC2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid
SMILESCOc1ccc2c(c1)NC(CC(=O)O)CS2
InChIInChI=1S/C11H13NO3S/c1-15-8-2-3-10-9(5-8)12-7(6-16-10)4-11(13)14/h2-3,5,7,12H,4,6H2,1H3,(H,13,14)
InChIKeyQFCNVGPFIADLKA-UHFFFAOYSA-N
MW239.30 g/mol
LogP2.06
Rot. Bonds3

About 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid

2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid (PubChem CID 84629451) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid
PubChem CID84629451
Molecular FormulaC11H13NO3S
Molecular Weight239.30 g/mol
Exact Mass239.06
IUPAC Name2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid
SMILESCOc1ccc2c(c1)NC(CC(=O)O)CS2
InChIInChI=1S/C11H13NO3S/c1-15-8-2-3-10-9(5-8)12-7(6-16-10)4-11(13)14/h2-3,5,7,12H,4,6H2,1H3,(H,13,14)
InChIKeyQFCNVGPFIADLKA-UHFFFAOYSA-N
XLogP2.06
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.30
LogP ≤ 52.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid?
The IUPAC name of 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid (CID 84629451) is 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid.
What is the SMILES notation for 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid?
The canonical SMILES for 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid is COc1ccc2c(c1)NC(CC(=O)O)CS2.
What is the InChIKey of 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid?
The InChIKey is QFCNVGPFIADLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-15-8-2-3-10-9(5-8)12-7(6-16-10)4-11(13)14/h2-3,5,7,12H,4,6H2,1H3,(H,13,14).
What are the key properties of 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid?
2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid has a molecular weight of 239.30 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methoxy-3,4-dihydro-2H-1,4-benzothiazin-3-yl)acetic acid is sourced from PubChem (CID 84629451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).