C12H13NO3S2 — CID 40560266
methyl 2-[(2R)-6-methoxy-3-sulfanylidene-4H-1,4-benzothiazin-2-yl]acetate (PubChem CID 40560266) has the molecular formula C12H13NO3S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 2-[(2R)-6-methoxy-3-sulfanylidene-4H-1,4-benzothiazin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-6-methoxy-3-sulfanylidene-4H-1,4-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 40560266 |
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | methyl 2-[(2R)-6-methoxy-3-sulfanylidene-4H-1,4-benzothiazin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1Sc2ccc(OC)cc2NC1=S |
| InChI | InChI=1S/C12H13NO3S2/c1-15-7-3-4-9-8(5-7)13-12(17)10(18-9)6-11(14)16-2/h3-5,10H,6H2,1-2H3,(H,13,17)/t10-/m1/s1 |
| InChIKey | QDBXTVWWIJURHC-SNVBAGLBSA-N |
| XLogP | 2.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|