C21H17NO6S — CID 2480887
(7-methoxy-2-oxochromen-4-yl)methyl 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate (PubChem CID 2480887) has the molecular formula C21H17NO6S and a molecular weight of 411.44 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 2480887 |
| Molecular Formula | C21H17NO6S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
| SMILES | COc1ccc2c(COC(=O)C[C@@H]3Sc4ccccc4NC3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H17NO6S/c1-26-13-6-7-14-12(8-20(24)28-16(14)9-13)11-27-19(23)10-18-21(25)22-15-4-2-3-5-17(15)29-18/h2-9,18H,10-11H2,1H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | ANIJAGIIVRSADG-SFHVURJKSA-N |
| XLogP | 3.35 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|