C20H22O5 — CID 7810301
(7-methoxy-2-oxochromen-4-yl)methyl 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 7810301) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 7810301 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | COc1ccc2c(COC(=O)C[C@H]3C[C@H]4CC[C@H]3C4)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H22O5/c1-23-16-4-5-17-15(9-20(22)25-18(17)10-16)11-24-19(21)8-14-7-12-2-3-13(14)6-12/h4-5,9-10,12-14H,2-3,6-8,11H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | BXNYLHIZFMGZBS-MELADBBJSA-N |
| XLogP | 3.67 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|