C23H28O4 — CID 6599141
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 6599141) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 6599141 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)C[C@H]3C[C@H]4CC[C@@H]3C4)c2cc1C(C)C |
| InChI | InChI=1S/C23H28O4/c1-13(2)19-11-20-18(10-23(25)27-21(20)6-14(19)3)12-26-22(24)9-17-8-15-4-5-16(17)7-15/h6,10-11,13,15-17H,4-5,7-9,12H2,1-3H3/t15-,16+,17+/m0/s1 |
| InChIKey | YEFFADSCHKFGFX-GVDBMIGSSA-N |
| XLogP | 5.09 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|