C24H23NO5S — CID 2449270
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate (PubChem CID 2449270) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 2449270 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)C[C@H]3Sc4ccccc4NC3=O)c2cc1C(C)C |
| InChI | InChI=1S/C24H23NO5S/c1-13(2)16-10-17-15(9-23(27)30-19(17)8-14(16)3)12-29-22(26)11-21-24(28)25-18-6-4-5-7-20(18)31-21/h4-10,13,21H,11-12H2,1-3H3,(H,25,28)/t21-/m1/s1 |
| InChIKey | KUJKOQMBFMKGTH-OAQYLSRUSA-N |
| XLogP | 4.77 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|