C22H19NO5S — CID 2478970
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate (PubChem CID 2478970) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 2478970 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
| SMILES | Cc1ccc2c(COC(=O)C[C@@H]3Sc4ccccc4NC3=O)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H19NO5S/c1-12-7-8-15-14(9-20(25)28-21(15)13(12)2)11-27-19(24)10-18-22(26)23-16-5-3-4-6-17(16)29-18/h3-9,18H,10-11H2,1-2H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | DYAPRQDAAPAVDE-SFHVURJKSA-N |
| XLogP | 3.96 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|