C19H19NO4S — CID 42966957
2-(3-methylphenoxy)ethyl 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate (PubChem CID 42966957) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate.
| Compound Name | 2-(3-methylphenoxy)ethyl 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
|---|---|
| PubChem CID | 42966957 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
| SMILES | Cc1cccc(OCCOC(=O)CC2Sc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C19H19NO4S/c1-13-5-4-6-14(11-13)23-9-10-24-18(21)12-17-19(22)20-15-7-2-3-8-16(15)25-17/h2-8,11,17H,9-10,12H2,1H3,(H,20,22) |
| InChIKey | WKCPZNIFWJLVBK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|