About ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate
ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate (PubChem CID 10333090) has the molecular formula C13H15NO3S
and a molecular weight of 265.33 g/mol. Its IUPAC name is ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
| PubChem CID | 10333090 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
| SMILES | CCOC(=O)CC1Sc2cc(C)ccc2NC1=O |
| InChI | InChI=1S/C13H15NO3S/c1-3-17-12(15)7-11-13(16)14-9-5-4-8(2)6-10(9)18-11/h4-6,11H,3,7H2,1-2H3,(H,14,16) |
| InChIKey | GIFCYCXJTXGCNL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The IUPAC name of ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate (CID 10333090) is ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate.
What is the SMILES notation for ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The canonical SMILES for ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate is CCOC(=O)CC1Sc2cc(C)ccc2NC1=O.
What is the InChIKey of ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The InChIKey is GIFCYCXJTXGCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3S/c1-3-17-12(15)7-11-13(16)14-9-5-4-8(2)6-10(9)18-11/h4-6,11H,3,7H2,1-2H3,(H,14,16).
What are the key properties of ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate has a molecular weight of 265.33 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(7-methyl-3-oxo-4H-1,4-benzothiazin-2-yl)acetate is sourced from PubChem (CID 10333090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).