C22H25NO6 — CID 11916751
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 11916751) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 11916751 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)C[C@H]3C[C@H]4CC[C@@H]3C4)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H25NO6/c1-2-27-22(26)23-17-5-6-18-16(10-21(25)29-19(18)11-17)12-28-20(24)9-15-8-13-3-4-14(15)7-13/h5-6,10-11,13-15H,2-4,7-9,12H2,1H3,(H,23,26)/t13-,14+,15+/m0/s1 |
| InChIKey | RRHBRVXVEJVISL-RRFJBIMHSA-N |
| XLogP | 4.23 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|