C22H24O4 — CID 23992407
[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 23992407) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 23992407 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | COc1ccc2cc(C(=O)COC(=O)CC3CC4CCC3C4)ccc2c1 |
| InChI | InChI=1S/C22H24O4/c1-25-20-7-6-16-10-18(5-4-17(16)11-20)21(23)13-26-22(24)12-19-9-14-2-3-15(19)8-14/h4-7,10-11,14-15,19H,2-3,8-9,12-13H2,1H3 |
| InChIKey | UWQMMDMKAHYIOY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |