C17H22O2 — CID 43379569
2-(2-bicyclo[2.2.1]heptanyl)-1-(4-methoxy-3-methylphenyl)ethanone (PubChem CID 43379569) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-methoxy-3-methylphenyl)ethanone.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-methoxy-3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 43379569 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-methoxy-3-methylphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CC2CC3CCC2C3)cc1C |
| InChI | InChI=1S/C17H22O2/c1-11-7-14(5-6-17(11)19-2)16(18)10-15-9-12-3-4-13(15)8-12/h5-7,12-13,15H,3-4,8-10H2,1-2H3 |
| InChIKey | JBIKZVJAMLABCL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |