C16H16BrF3O — CID 115784998
2-(2-bicyclo[2.2.1]heptanyl)-1-[4-bromo-3-(trifluoromethyl)phenyl]ethanone (PubChem CID 115784998) has the molecular formula C16H16BrF3O and a molecular weight of 361.20 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-[4-bromo-3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-[4-bromo-3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 115784998 |
| Molecular Formula | C16H16BrF3O |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-[4-bromo-3-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(CC1CC2CCC1C2)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16BrF3O/c17-14-4-3-11(7-13(14)16(18,19)20)15(21)8-12-6-9-1-2-10(12)5-9/h3-4,7,9-10,12H,1-2,5-6,8H2 |
| InChIKey | VXNQCLXOJOMLEW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |