C16H17NO3 — CID 43340126
6-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-3H-1,3-benzoxazol-2-one (PubChem CID 43340126) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 6-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43340126 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 6-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(CC1CC2CCC1C2)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C16H17NO3/c18-14(7-12-6-9-1-2-10(12)5-9)11-3-4-13-15(8-11)20-16(19)17-13/h3-4,8-10,12H,1-2,5-7H2,(H,17,19) |
| InChIKey | VSKNKSCOWSUIDW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |