C11H10ClNO3S — CID 40591772
methyl 2-[(2R)-6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl]acetate (PubChem CID 40591772) has the molecular formula C11H10ClNO3S and a molecular weight of 271.73 g/mol. Its IUPAC name is methyl 2-[(2R)-6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 40591772 |
| Molecular Formula | C11H10ClNO3S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | methyl 2-[(2R)-6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1Sc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C11H10ClNO3S/c1-16-10(14)5-9-11(15)13-7-4-6(12)2-3-8(7)17-9/h2-4,9H,5H2,1H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | MLVFADKZFKFSET-SECBINFHSA-N |
| XLogP | 2.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |