C19H17ClN2O4S — CID 2918421
ethyl 2-[[2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]benzoate (PubChem CID 2918421) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is ethyl 2-[[2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2918421 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | ethyl 2-[[2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CC1Sc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C19H17ClN2O4S/c1-2-26-19(25)12-5-3-4-6-13(12)21-17(23)10-16-18(24)22-14-9-11(20)7-8-15(14)27-16/h3-9,16H,2,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | SRZOYEPOVFCAJM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |