C15H20O4 — CID 66652406
2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid (PubChem CID 66652406) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 66652406 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid |
| SMILES | COc1ccc(OC)c(C2CCCC2CC(=O)O)c1 |
| InChI | InChI=1S/C15H20O4/c1-18-11-6-7-14(19-2)13(9-11)12-5-3-4-10(12)8-15(16)17/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | ZVTFXOHUMAIGIH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |