2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid

C15H20O4 — CID 66652406

IUPAC2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid
SMILESCOc1ccc(OC)c(C2CCCC2CC(=O)O)c1
InChIInChI=1S/C15H20O4/c1-18-11-6-7-14(19-2)13(9-11)12-5-3-4-10(12)8-15(16)17/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,16,17)
InChIKeyZVTFXOHUMAIGIH-UHFFFAOYSA-N
MW264.32 g/mol
LogP3.06
Rot. Bonds5

About 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid

2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid (PubChem CID 66652406) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid.

Molecular Properties

Compound Name2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid
PubChem CID66652406
Molecular FormulaC15H20O4
Molecular Weight264.32 g/mol
Exact Mass264.14
IUPAC Name2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid
SMILESCOc1ccc(OC)c(C2CCCC2CC(=O)O)c1
InChIInChI=1S/C15H20O4/c1-18-11-6-7-14(19-2)13(9-11)12-5-3-4-10(12)8-15(16)17/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,16,17)
InChIKeyZVTFXOHUMAIGIH-UHFFFAOYSA-N
XLogP3.06
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid?
The IUPAC name of 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid (CID 66652406) is 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid.
What is the SMILES notation for 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid?
The canonical SMILES for 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid is COc1ccc(OC)c(C2CCCC2CC(=O)O)c1.
What is the InChIKey of 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid?
The InChIKey is ZVTFXOHUMAIGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-18-11-6-7-14(19-2)13(9-11)12-5-3-4-10(12)8-15(16)17/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,16,17).
What are the key properties of 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid?
2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid has a molecular weight of 264.32 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dimethoxyphenyl)cyclopentyl]acetic acid is sourced from PubChem (CID 66652406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).