C17H25NO5 — CID 21364620
N-methoxy-2-[5-methoxy-2-(methoxymethoxy)phenyl]-N-methylcyclopentane-1-carboxamide (PubChem CID 21364620) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is N-methoxy-2-[5-methoxy-2-(methoxymethoxy)phenyl]-N-methylcyclopentane-1-carboxamide.
| Compound Name | N-methoxy-2-[5-methoxy-2-(methoxymethoxy)phenyl]-N-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 21364620 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-methoxy-2-[5-methoxy-2-(methoxymethoxy)phenyl]-N-methylcyclopentane-1-carboxamide |
| SMILES | COCOc1ccc(OC)cc1C1CCCC1C(=O)N(C)OC |
| InChI | InChI=1S/C17H25NO5/c1-18(22-4)17(19)14-7-5-6-13(14)15-10-12(21-3)8-9-16(15)23-11-20-2/h8-10,13-14H,5-7,11H2,1-4H3 |
| InChIKey | JGEPVWFPVDMZIT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|