C17H23NO6 — CID 19802571
3-(2,5-dimethoxyphenyl)-1-azabicyclo[2.2.2]octane;oxalic acid (PubChem CID 19802571) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-azabicyclo[2.2.2]octane;oxalic acid.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-azabicyclo[2.2.2]octane;oxalic acid |
|---|---|
| PubChem CID | 19802571 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-azabicyclo[2.2.2]octane;oxalic acid |
| SMILES | COc1ccc(OC)c(C2CN3CCC2CC3)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H21NO2.C2H2O4/c1-17-12-3-4-15(18-2)13(9-12)14-10-16-7-5-11(14)6-8-16;3-1(4)2(5)6/h3-4,9,11,14H,5-8,10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | LWMOTPGDQFFNNH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|