C15H22N2O2 — CID 105363627
N-(2,5-dimethoxyphenyl)-1-azabicyclo[3.2.1]octan-4-amine (PubChem CID 105363627) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-1-azabicyclo[3.2.1]octan-4-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-1-azabicyclo[3.2.1]octan-4-amine |
|---|---|
| PubChem CID | 105363627 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-1-azabicyclo[3.2.1]octan-4-amine |
| SMILES | COc1ccc(OC)c(NC2CCN3CCC2C3)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-18-12-3-4-15(19-2)14(9-12)16-13-6-8-17-7-5-11(13)10-17/h3-4,9,11,13,16H,5-8,10H2,1-2H3 |
| InChIKey | VBLICQSZVKINDG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |