C25H30N2O4 — CID 42681551
[1-benzoyl-4-(2,5-dimethoxyphenyl)pyrrolidin-3-yl]-piperidin-1-ylmethanone (PubChem CID 42681551) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [1-benzoyl-4-(2,5-dimethoxyphenyl)pyrrolidin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-benzoyl-4-(2,5-dimethoxyphenyl)pyrrolidin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 42681551 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [1-benzoyl-4-(2,5-dimethoxyphenyl)pyrrolidin-3-yl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc(OC)c(C2CN(C(=O)c3ccccc3)CC2C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C25H30N2O4/c1-30-19-11-12-23(31-2)20(15-19)21-16-27(24(28)18-9-5-3-6-10-18)17-22(21)25(29)26-13-7-4-8-14-26/h3,5-6,9-12,15,21-22H,4,7-8,13-14,16-17H2,1-2H3 |
| InChIKey | HRRJNJXETDZCDK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |