C21H29N3O3S — CID 93154544
(3S,4S)-N-cyclopropyl-3-(2,5-dimethoxyphenyl)-4-(pyrrolidine-1-carbonyl)pyrrolidine-1-carbothioamide (PubChem CID 93154544) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is (3S,4S)-N-cyclopropyl-3-(2,5-dimethoxyphenyl)-4-(pyrrolidine-1-carbonyl)pyrrolidine-1-carbothioamide.
| Compound Name | (3S,4S)-N-cyclopropyl-3-(2,5-dimethoxyphenyl)-4-(pyrrolidine-1-carbonyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 93154544 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (3S,4S)-N-cyclopropyl-3-(2,5-dimethoxyphenyl)-4-(pyrrolidine-1-carbonyl)pyrrolidine-1-carbothioamide |
| SMILES | COc1ccc(OC)c([C@H]2CN(C(=S)NC3CC3)C[C@H]2C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H29N3O3S/c1-26-15-7-8-19(27-2)16(11-15)17-12-24(21(28)22-14-5-6-14)13-18(17)20(25)23-9-3-4-10-23/h7-8,11,14,17-18H,3-6,9-10,12-13H2,1-2H3,(H,22,28)/t17-,18-/m1/s1 |
| InChIKey | QABRLFMHXCDIPP-QZTJIDSGSA-N |
| XLogP | 2.38 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|