C23H28N4O3S — CID 93154539
(3S,4R)-1-(cyclopropylcarbamothioyl)-4-(2,5-dimethoxyphenyl)-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 93154539) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is (3S,4R)-1-(cyclopropylcarbamothioyl)-4-(2,5-dimethoxyphenyl)-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-1-(cyclopropylcarbamothioyl)-4-(2,5-dimethoxyphenyl)-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93154539 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (3S,4R)-1-(cyclopropylcarbamothioyl)-4-(2,5-dimethoxyphenyl)-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c([C@@H]2CN(C(=S)NC3CC3)C[C@H]2C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C23H28N4O3S/c1-29-17-8-9-21(30-2)18(11-17)19-13-27(23(31)26-15-6-7-15)14-20(19)22(28)25-12-16-5-3-4-10-24-16/h3-5,8-11,15,19-20H,6-7,12-14H2,1-2H3,(H,25,28)(H,26,31)/t19-,20+/m0/s1 |
| InChIKey | FVEKUKMXQMAPNO-VQTJNVASSA-N |
| XLogP | 2.47 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|