C28H30N2O4 — CID 97479093
(3R,4R)-N-benzyl-4-(2,5-dimethoxyphenyl)-1-(2-phenylacetyl)pyrrolidine-3-carboxamide (PubChem CID 97479093) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is (3R,4R)-N-benzyl-4-(2,5-dimethoxyphenyl)-1-(2-phenylacetyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-benzyl-4-(2,5-dimethoxyphenyl)-1-(2-phenylacetyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97479093 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (3R,4R)-N-benzyl-4-(2,5-dimethoxyphenyl)-1-(2-phenylacetyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c([C@@H]2CN(C(=O)Cc3ccccc3)C[C@@H]2C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C28H30N2O4/c1-33-22-13-14-26(34-2)23(16-22)24-18-30(27(31)15-20-9-5-3-6-10-20)19-25(24)28(32)29-17-21-11-7-4-8-12-21/h3-14,16,24-25H,15,17-19H2,1-2H3,(H,29,32)/t24-,25-/m0/s1 |
| InChIKey | JBFHHIZOZAWKHW-DQEYMECFSA-N |
| XLogP | 3.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |