C23H29N3O4 — CID 93150989
(3R,4S)-3-N-benzyl-4-(2,5-dimethoxyphenyl)-1-N-ethylpyrrolidine-1,3-dicarboxamide (PubChem CID 93150989) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is (3R,4S)-3-N-benzyl-4-(2,5-dimethoxyphenyl)-1-N-ethylpyrrolidine-1,3-dicarboxamide.
| Compound Name | (3R,4S)-3-N-benzyl-4-(2,5-dimethoxyphenyl)-1-N-ethylpyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93150989 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (3R,4S)-3-N-benzyl-4-(2,5-dimethoxyphenyl)-1-N-ethylpyrrolidine-1,3-dicarboxamide |
| SMILES | CCNC(=O)N1C[C@H](C(=O)NCc2ccccc2)[C@@H](c2cc(OC)ccc2OC)C1 |
| InChI | InChI=1S/C23H29N3O4/c1-4-24-23(28)26-14-19(18-12-17(29-2)10-11-21(18)30-3)20(15-26)22(27)25-13-16-8-6-5-7-9-16/h5-12,19-20H,4,13-15H2,1-3H3,(H,24,28)(H,25,27)/t19-,20+/m1/s1 |
| InChIKey | QXGOMYCXIAUADO-UXHICEINSA-N |
| XLogP | 2.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |