C23H26N2O4 — CID 42681054
[1-benzoyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 42681054) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [1-benzoyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-benzoyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 42681054 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [1-benzoyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccccc1C1CN(C(=O)c2ccccc2)CC1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H26N2O4/c1-28-21-10-6-5-9-18(21)19-15-25(22(26)17-7-3-2-4-8-17)16-20(19)23(27)24-11-13-29-14-12-24/h2-10,19-20H,11-16H2,1H3 |
| InChIKey | NAAQSDVFBFYWEE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |