C17H19N3O3 — CID 70783397
[3-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-pyridazin-3-ylmethanone (PubChem CID 70783397) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is [3-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-pyridazin-3-ylmethanone.
| Compound Name | [3-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-pyridazin-3-ylmethanone |
|---|---|
| PubChem CID | 70783397 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [3-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-pyridazin-3-ylmethanone |
| SMILES | COc1ccc(OC)c(C2CCN(C(=O)c3cccnn3)C2)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-22-13-5-6-16(23-2)14(10-13)12-7-9-20(11-12)17(21)15-4-3-8-18-19-15/h3-6,8,10,12H,7,9,11H2,1-2H3 |
| InChIKey | IRYUWCVPSBFHHQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |