C9H12BNO3 — CID 57451835
2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine (PubChem CID 57451835) has the molecular formula C9H12BNO3 and a molecular weight of 193.01 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 57451835 |
| Molecular Formula | C9H12BNO3 |
| Molecular Weight | 193.01 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine |
| SMILES | NCCOc1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C9H12BNO3/c11-4-5-13-8-3-1-2-7-6-14-10(12)9(7)8/h1-3,12H,4-6,11H2 |
| InChIKey | IZPWIORXGLQAMV-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.01 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|