About 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine
2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine (PubChem CID 57451835) has the molecular formula C9H12BNO3
and a molecular weight of 193.01 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine.
Molecular Properties
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine |
| PubChem CID | 57451835 |
| Molecular Formula | C9H12BNO3 |
| Molecular Weight | 193.01 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine |
| SMILES | NCCOc1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C9H12BNO3/c11-4-5-13-8-3-1-2-7-6-14-10(12)9(7)8/h1-3,12H,4-6,11H2 |
| InChIKey | IZPWIORXGLQAMV-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.01 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine?
The IUPAC name of 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine (CID 57451835) is 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine.
What is the SMILES notation for 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine?
The canonical SMILES for 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine is NCCOc1cccc2c1B(O)OC2.
What is the InChIKey of 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine?
The InChIKey is IZPWIORXGLQAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BNO3/c11-4-5-13-8-3-1-2-7-6-14-10(12)9(7)8/h1-3,12H,4-6,11H2.
What are the key properties of 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine?
2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine has a molecular weight of 193.01 g/mol, XLogP of -0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]ethanamine is sourced from PubChem (CID 57451835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).