C15H21BO3 — CID 58404065
1-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-5,5-dimethylhexan-3-one (PubChem CID 58404065) has the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. Its IUPAC name is 1-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-5,5-dimethylhexan-3-one.
| Compound Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-5,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 58404065 |
| Molecular Formula | C15H21BO3 |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-5,5-dimethylhexan-3-one |
| SMILES | CC(C)(C)CC(=O)CCc1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C15H21BO3/c1-15(2,3)9-13(17)8-7-11-5-4-6-12-10-19-16(18)14(11)12/h4-6,18H,7-10H2,1-3H3 |
| InChIKey | OACZTMBBFZZVFY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|