C21H21BN2O4 — CID 146081535
N-(2-ethyl-4-oxo-1H-quinolin-6-yl)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanamide (PubChem CID 146081535) has the molecular formula C21H21BN2O4 and a molecular weight of 376.22 g/mol. Its IUPAC name is N-(2-ethyl-4-oxo-1H-quinolin-6-yl)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanamide.
| Compound Name | N-(2-ethyl-4-oxo-1H-quinolin-6-yl)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanamide |
|---|---|
| PubChem CID | 146081535 |
| Molecular Formula | C21H21BN2O4 |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-(2-ethyl-4-oxo-1H-quinolin-6-yl)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanamide |
| SMILES | CCc1cc(=O)c2cc(NC(=O)CCc3cccc4c3B(O)OC4)ccc2[nH]1 |
| InChI | InChI=1S/C21H21BN2O4/c1-2-15-11-19(25)17-10-16(7-8-18(17)23-15)24-20(26)9-6-13-4-3-5-14-12-28-22(27)21(13)14/h3-5,7-8,10-11,27H,2,6,9,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | KMKFUXZXOFXBGE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|