C20H24BNO3 — CID 155531287
N-(4-tert-butylphenyl)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanamide (PubChem CID 155531287) has the molecular formula C20H24BNO3 and a molecular weight of 337.23 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanamide.
| Compound Name | N-(4-tert-butylphenyl)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanamide |
|---|---|
| PubChem CID | 155531287 |
| Molecular Formula | C20H24BNO3 |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)CCc2cccc3c2B(O)OC3)cc1 |
| InChI | InChI=1S/C20H24BNO3/c1-20(2,3)16-8-10-17(11-9-16)22-18(23)12-7-14-5-4-6-15-13-25-21(24)19(14)15/h4-6,8-11,24H,7,12-13H2,1-3H3,(H,22,23) |
| InChIKey | BRAJZERDUODMHM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|