C22H23BN2O3 — CID 139014800
4-[1-[3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoyl]piperidin-4-yl]benzonitrile (PubChem CID 139014800) has the molecular formula C22H23BN2O3 and a molecular weight of 374.25 g/mol. Its IUPAC name is 4-[1-[3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoyl]piperidin-4-yl]benzonitrile.
| Compound Name | 4-[1-[3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoyl]piperidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 139014800 |
| Molecular Formula | C22H23BN2O3 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-[1-[3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoyl]piperidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCN(C(=O)CCc3cccc4c3B(O)OC4)CC2)cc1 |
| InChI | InChI=1S/C22H23BN2O3/c24-14-16-4-6-17(7-5-16)18-10-12-25(13-11-18)21(26)9-8-19-2-1-3-20-15-28-23(27)22(19)20/h1-7,18,27H,8-13,15H2 |
| InChIKey | LXCBDGDYOBDPOW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|