C38H40N4O4 — CID 175395318
methyl 2,3-bis[4-(4-cyanophenyl)piperidine-1-carbonyl]-4,6-diethylbenzoate (PubChem CID 175395318) has the molecular formula C38H40N4O4 and a molecular weight of 616.76 g/mol. Its IUPAC name is methyl 2,3-bis[4-(4-cyanophenyl)piperidine-1-carbonyl]-4,6-diethylbenzoate.
| Compound Name | methyl 2,3-bis[4-(4-cyanophenyl)piperidine-1-carbonyl]-4,6-diethylbenzoate |
|---|---|
| PubChem CID | 175395318 |
| Molecular Formula | C38H40N4O4 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | methyl 2,3-bis[4-(4-cyanophenyl)piperidine-1-carbonyl]-4,6-diethylbenzoate |
| SMILES | CCc1cc(CC)c(C(=O)N2CCC(c3ccc(C#N)cc3)CC2)c(C(=O)N2CCC(c3ccc(C#N)cc3)CC2)c1C(=O)OC |
| InChI | InChI=1S/C38H40N4O4/c1-4-27-22-28(5-2)34(38(45)46-3)35(37(44)42-20-16-32(17-21-42)30-12-8-26(24-40)9-13-30)33(27)36(43)41-18-14-31(15-19-41)29-10-6-25(23-39)7-11-29/h6-13,22,31-32H,4-5,14-21H2,1-3H3 |
| InChIKey | VJMACXKMHMIKEP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 114.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |