C24H30N4O2 — CID 175281301
4-[1-(2,4-diethylbenzoyl)piperidin-4-yl]benzonitrile;formohydrazide (PubChem CID 175281301) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[1-(2,4-diethylbenzoyl)piperidin-4-yl]benzonitrile;formohydrazide.
| Compound Name | 4-[1-(2,4-diethylbenzoyl)piperidin-4-yl]benzonitrile;formohydrazide |
|---|---|
| PubChem CID | 175281301 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-[1-(2,4-diethylbenzoyl)piperidin-4-yl]benzonitrile;formohydrazide |
| SMILES | CCc1ccc(C(=O)N2CCC(c3ccc(C#N)cc3)CC2)c(CC)c1.NNC=O |
| InChI | InChI=1S/C23H26N2O.CH4N2O/c1-3-17-7-10-22(19(4-2)15-17)23(26)25-13-11-21(12-14-25)20-8-5-18(16-24)6-9-20;2-3-1-4/h5-10,15,21H,3-4,11-14H2,1-2H3;1H,2H2,(H,3,4) |
| InChIKey | PZGKDDWJFOPGAE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|