C25H26N2O2 — CID 86672547
4-[1-(4-cyclobutyl-5-formyl-2-methylbenzoyl)piperidin-4-yl]benzonitrile (PubChem CID 86672547) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-[1-(4-cyclobutyl-5-formyl-2-methylbenzoyl)piperidin-4-yl]benzonitrile.
| Compound Name | 4-[1-(4-cyclobutyl-5-formyl-2-methylbenzoyl)piperidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 86672547 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 4-[1-(4-cyclobutyl-5-formyl-2-methylbenzoyl)piperidin-4-yl]benzonitrile |
| SMILES | Cc1cc(C2CCC2)c(C=O)cc1C(=O)N1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C25H26N2O2/c1-17-13-24(21-3-2-4-21)22(16-28)14-23(17)25(29)27-11-9-20(10-12-27)19-7-5-18(15-26)6-8-19/h5-8,13-14,16,20-21H,2-4,9-12H2,1H3 |
| InChIKey | SERVZOOYMJECNL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|